C9H12O4 — CID 139788326
(Z)-3-methyl-4-(2-methylprop-2-enoxy)-4-oxobut-2-enoic acid (PubChem CID 139788326) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (Z)-3-methyl-4-(2-methylprop-2-enoxy)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-3-methyl-4-(2-methylprop-2-enoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 139788326 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (Z)-3-methyl-4-(2-methylprop-2-enoxy)-4-oxobut-2-enoic acid |
| SMILES | C=C(C)COC(=O)/C(C)=C\C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-6(2)5-13-9(12)7(3)4-8(10)11/h4H,1,5H2,2-3H3,(H,10,11)/b7-4- |
| InChIKey | YAYGNCFWJKBIPT-DAXSKMNVSA-N |
| XLogP | 1.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|