C9H14O5 — CID 174918745
(Z)-4-(4-hydroxybutoxy)-3-methyl-4-oxobut-2-enoic acid (PubChem CID 174918745) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (Z)-4-(4-hydroxybutoxy)-3-methyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(4-hydroxybutoxy)-3-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 174918745 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (Z)-4-(4-hydroxybutoxy)-3-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)C(=O)OCCCCO |
| InChI | InChI=1S/C9H14O5/c1-7(6-8(11)12)9(13)14-5-3-2-4-10/h6,10H,2-5H2,1H3,(H,11,12)/b7-6- |
| InChIKey | DQEOGSAORZZBNZ-SREVYHEPSA-N |
| XLogP | 0.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|