C14H22O6 — CID 178064848
1-O-(4-hydroxybutyl) 6-O-(2-hydroxyethyl) (2E,4E)-2,5-dimethylhexa-2,4-dienedioate (PubChem CID 178064848) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-O-(4-hydroxybutyl) 6-O-(2-hydroxyethyl) (2E,4E)-2,5-dimethylhexa-2,4-dienedioate.
| Compound Name | 1-O-(4-hydroxybutyl) 6-O-(2-hydroxyethyl) (2E,4E)-2,5-dimethylhexa-2,4-dienedioate |
|---|---|
| PubChem CID | 178064848 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-O-(4-hydroxybutyl) 6-O-(2-hydroxyethyl) (2E,4E)-2,5-dimethylhexa-2,4-dienedioate |
| SMILES | C/C(=C\C=C(/C)C(=O)OCCCCO)C(=O)OCCO |
| InChI | InChI=1S/C14H22O6/c1-11(13(17)19-9-4-3-7-15)5-6-12(2)14(18)20-10-8-16/h5-6,15-16H,3-4,7-10H2,1-2H3/b11-5+,12-6+ |
| InChIKey | OFQQHSULVAMMLJ-YDWXAUTNSA-N |
| XLogP | 0.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|