About azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride
azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride (PubChem CID 173093194) has the molecular formula C8H18ClNO3
and a molecular weight of 211.69 g/mol. Its IUPAC name is azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride |
| PubChem CID | 173093194 |
| Molecular Formula | C8H18ClNO3 |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride |
| SMILES | CC=C(C)C(=O)OCCCO.Cl.N |
| InChI | InChI=1S/C8H14O3.ClH.H3N/c1-3-7(2)8(10)11-6-4-5-9;;/h3,9H,4-6H2,1-2H3;1H;1H3 |
| InChIKey | OBNZCOGKULWUBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride?
The IUPAC name of azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride (CID 173093194) is azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride.
What is the SMILES notation for azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride?
The canonical SMILES for azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride is CC=C(C)C(=O)OCCCO.Cl.N.
What is the InChIKey of azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride?
The InChIKey is OBNZCOGKULWUBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.ClH.H3N/c1-3-7(2)8(10)11-6-4-5-9;;/h3,9H,4-6H2,1-2H3;1H;1H3.
What are the key properties of azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride?
azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride has a molecular weight of 211.69 g/mol, XLogP of 1.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-hydroxypropyl 2-methylbut-2-enoate;hydrochloride is sourced from PubChem (CID 173093194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).