About hydroxymethyl (E)-2-methylbut-2-enoate
hydroxymethyl (E)-2-methylbut-2-enoate (PubChem CID 87487357) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is hydroxymethyl (E)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | hydroxymethyl (E)-2-methylbut-2-enoate |
| PubChem CID | 87487357 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | hydroxymethyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCO |
| InChI | InChI=1S/C6H10O3/c1-3-5(2)6(8)9-4-7/h3,7H,4H2,1-2H3/b5-3+ |
| InChIKey | SGLDRZRTFSJPDT-HWKANZROSA-N |
| XLogP | 0.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethyl (E)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethyl (E)-2-methylbut-2-enoate?
The IUPAC name of hydroxymethyl (E)-2-methylbut-2-enoate (CID 87487357) is hydroxymethyl (E)-2-methylbut-2-enoate.
What is the SMILES notation for hydroxymethyl (E)-2-methylbut-2-enoate?
The canonical SMILES for hydroxymethyl (E)-2-methylbut-2-enoate is C/C=C(\C)C(=O)OCO.
What is the InChIKey of hydroxymethyl (E)-2-methylbut-2-enoate?
The InChIKey is SGLDRZRTFSJPDT-HWKANZROSA-N. The full InChI is InChI=1S/C6H10O3/c1-3-5(2)6(8)9-4-7/h3,7H,4H2,1-2H3/b5-3+.
What are the key properties of hydroxymethyl (E)-2-methylbut-2-enoate?
hydroxymethyl (E)-2-methylbut-2-enoate has a molecular weight of 130.14 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethyl (E)-2-methylbut-2-enoate is sourced from PubChem (CID 87487357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).