About ethanamine;methyl 2-methylbut-2-enoate
ethanamine;methyl 2-methylbut-2-enoate (PubChem CID 175288046) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is ethanamine;methyl 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | ethanamine;methyl 2-methylbut-2-enoate |
| PubChem CID | 175288046 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | ethanamine;methyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC.CCN |
| InChI | InChI=1S/C6H10O2.C2H7N/c1-4-5(2)6(7)8-3;1-2-3/h4H,1-3H3;2-3H2,1H3 |
| InChIKey | ABQKLAHRDYDIQH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;methyl 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;methyl 2-methylbut-2-enoate?
The IUPAC name of ethanamine;methyl 2-methylbut-2-enoate (CID 175288046) is ethanamine;methyl 2-methylbut-2-enoate.
What is the SMILES notation for ethanamine;methyl 2-methylbut-2-enoate?
The canonical SMILES for ethanamine;methyl 2-methylbut-2-enoate is CC=C(C)C(=O)OC.CCN.
What is the InChIKey of ethanamine;methyl 2-methylbut-2-enoate?
The InChIKey is ABQKLAHRDYDIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C2H7N/c1-4-5(2)6(7)8-3;1-2-3/h4H,1-3H3;2-3H2,1H3.
What are the key properties of ethanamine;methyl 2-methylbut-2-enoate?
ethanamine;methyl 2-methylbut-2-enoate has a molecular weight of 159.23 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;methyl 2-methylbut-2-enoate is sourced from PubChem (CID 175288046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).