About 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate
4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate (PubChem CID 15441035) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate.
Molecular Properties
| Compound Name | 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate |
| PubChem CID | 15441035 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C8H12O4/c1-4-12-7(9)5-6(2)8(10)11-3/h5H,4H2,1-3H3/b6-5+ |
| InChIKey | GERHSFWFMNSNCM-AATRIKPKSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate?
The IUPAC name of 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate (CID 15441035) is 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate.
What is the SMILES notation for 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate?
The canonical SMILES for 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate is CCOC(=O)/C=C(\C)C(=O)OC.
What is the InChIKey of 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate?
The InChIKey is GERHSFWFMNSNCM-AATRIKPKSA-N. The full InChI is InChI=1S/C8H12O4/c1-4-12-7(9)5-6(2)8(10)11-3/h5H,4H2,1-3H3/b6-5+.
What are the key properties of 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate?
4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate has a molecular weight of 172.18 g/mol, XLogP of 0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-ethyl 1-O-methyl (E)-2-methylbut-2-enedioate is sourced from PubChem (CID 15441035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).