About azane;dimethyl (E)-2-methylbut-2-enedioate
azane;dimethyl (E)-2-methylbut-2-enedioate (PubChem CID 139366978) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is azane;dimethyl (E)-2-methylbut-2-enedioate.
Molecular Properties
| Compound Name | azane;dimethyl (E)-2-methylbut-2-enedioate |
| PubChem CID | 139366978 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | azane;dimethyl (E)-2-methylbut-2-enedioate |
| SMILES | COC(=O)/C=C(\C)C(=O)OC.N |
| InChI | InChI=1S/C7H10O4.H3N/c1-5(7(9)11-3)4-6(8)10-2;/h4H,1-3H3;1H3/b5-4+; |
| InChIKey | MGLYSEWMXAIRRW-FXRZFVDSSA-N |
| XLogP | 0.44 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;dimethyl (E)-2-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;dimethyl (E)-2-methylbut-2-enedioate?
The IUPAC name of azane;dimethyl (E)-2-methylbut-2-enedioate (CID 139366978) is azane;dimethyl (E)-2-methylbut-2-enedioate.
What is the SMILES notation for azane;dimethyl (E)-2-methylbut-2-enedioate?
The canonical SMILES for azane;dimethyl (E)-2-methylbut-2-enedioate is COC(=O)/C=C(\C)C(=O)OC.N.
What is the InChIKey of azane;dimethyl (E)-2-methylbut-2-enedioate?
The InChIKey is MGLYSEWMXAIRRW-FXRZFVDSSA-N. The full InChI is InChI=1S/C7H10O4.H3N/c1-5(7(9)11-3)4-6(8)10-2;/h4H,1-3H3;1H3/b5-4+;.
What are the key properties of azane;dimethyl (E)-2-methylbut-2-enedioate?
azane;dimethyl (E)-2-methylbut-2-enedioate has a molecular weight of 175.18 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;dimethyl (E)-2-methylbut-2-enedioate is sourced from PubChem (CID 139366978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).