About acetic acid;methyl 2-methyl-4-oxopent-2-enoate
acetic acid;methyl 2-methyl-4-oxopent-2-enoate (PubChem CID 174282398) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is acetic acid;methyl 2-methyl-4-oxopent-2-enoate.
Molecular Properties
| Compound Name | acetic acid;methyl 2-methyl-4-oxopent-2-enoate |
| PubChem CID | 174282398 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | acetic acid;methyl 2-methyl-4-oxopent-2-enoate |
| SMILES | CC(=O)O.COC(=O)C(C)=CC(C)=O |
| InChI | InChI=1S/C7H10O3.C2H4O2/c1-5(4-6(2)8)7(9)10-3;1-2(3)4/h4H,1-3H3;1H3,(H,3,4) |
| InChIKey | GCJQBHVMHBNNSA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;methyl 2-methyl-4-oxopent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;methyl 2-methyl-4-oxopent-2-enoate?
The IUPAC name of acetic acid;methyl 2-methyl-4-oxopent-2-enoate (CID 174282398) is acetic acid;methyl 2-methyl-4-oxopent-2-enoate.
What is the SMILES notation for acetic acid;methyl 2-methyl-4-oxopent-2-enoate?
The canonical SMILES for acetic acid;methyl 2-methyl-4-oxopent-2-enoate is CC(=O)O.COC(=O)C(C)=CC(C)=O.
What is the InChIKey of acetic acid;methyl 2-methyl-4-oxopent-2-enoate?
The InChIKey is GCJQBHVMHBNNSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C2H4O2/c1-5(4-6(2)8)7(9)10-3;1-2(3)4/h4H,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;methyl 2-methyl-4-oxopent-2-enoate?
acetic acid;methyl 2-methyl-4-oxopent-2-enoate has a molecular weight of 202.21 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;methyl 2-methyl-4-oxopent-2-enoate is sourced from PubChem (CID 174282398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).