C13H23NO3 — CID 91392043
methyl 2-methylbut-2-enoate;N,N,2-trimethylbut-2-enamide (PubChem CID 91392043) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is methyl 2-methylbut-2-enoate;N,N,2-trimethylbut-2-enamide.
| Compound Name | methyl 2-methylbut-2-enoate;N,N,2-trimethylbut-2-enamide |
|---|---|
| PubChem CID | 91392043 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | methyl 2-methylbut-2-enoate;N,N,2-trimethylbut-2-enamide |
| SMILES | CC=C(C)C(=O)N(C)C.CC=C(C)C(=O)OC |
| InChI | InChI=1S/C7H13NO.C6H10O2/c1-5-6(2)7(9)8(3)4;1-4-5(2)6(7)8-3/h5H,1-4H3;4H,1-3H3 |
| InChIKey | RHOSGOLBFFUKDG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|