About ethane;methyl 2-oxopropanoate
ethane;methyl 2-oxopropanoate (PubChem CID 142946473) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is ethane;methyl 2-oxopropanoate.
Molecular Properties
| Compound Name | ethane;methyl 2-oxopropanoate |
| PubChem CID | 142946473 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | ethane;methyl 2-oxopropanoate |
| SMILES | CC.COC(=O)C(C)=O |
| InChI | InChI=1S/C4H6O3.C2H6/c1-3(5)4(6)7-2;1-2/h1-2H3;1-2H3 |
| InChIKey | NQSLTIZQBIFWLV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-oxopropanoate?
The IUPAC name of ethane;methyl 2-oxopropanoate (CID 142946473) is ethane;methyl 2-oxopropanoate.
What is the SMILES notation for ethane;methyl 2-oxopropanoate?
The canonical SMILES for ethane;methyl 2-oxopropanoate is CC.COC(=O)C(C)=O.
What is the InChIKey of ethane;methyl 2-oxopropanoate?
The InChIKey is NQSLTIZQBIFWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C2H6/c1-3(5)4(6)7-2;1-2/h1-2H3;1-2H3.
What are the key properties of ethane;methyl 2-oxopropanoate?
ethane;methyl 2-oxopropanoate has a molecular weight of 132.16 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-oxopropanoate is sourced from PubChem (CID 142946473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).