About 2-aminopentanoic acid;methyl 2-oxopropanoate
2-aminopentanoic acid;methyl 2-oxopropanoate (PubChem CID 144928347) has the molecular formula C9H17NO5
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-aminopentanoic acid;methyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 2-aminopentanoic acid;methyl 2-oxopropanoate |
| PubChem CID | 144928347 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-aminopentanoic acid;methyl 2-oxopropanoate |
| SMILES | CCCC(N)C(=O)O.COC(=O)C(C)=O |
| InChI | InChI=1S/C5H11NO2.C4H6O3/c1-2-3-4(6)5(7)8;1-3(5)4(6)7-2/h4H,2-3,6H2,1H3,(H,7,8);1-2H3 |
| InChIKey | LHXPSXXWMCRBGA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopentanoic acid;methyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanoic acid;methyl 2-oxopropanoate?
The IUPAC name of 2-aminopentanoic acid;methyl 2-oxopropanoate (CID 144928347) is 2-aminopentanoic acid;methyl 2-oxopropanoate.
What is the SMILES notation for 2-aminopentanoic acid;methyl 2-oxopropanoate?
The canonical SMILES for 2-aminopentanoic acid;methyl 2-oxopropanoate is CCCC(N)C(=O)O.COC(=O)C(C)=O.
What is the InChIKey of 2-aminopentanoic acid;methyl 2-oxopropanoate?
The InChIKey is LHXPSXXWMCRBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C4H6O3/c1-2-3-4(6)5(7)8;1-3(5)4(6)7-2/h4H,2-3,6H2,1H3,(H,7,8);1-2H3.
What are the key properties of 2-aminopentanoic acid;methyl 2-oxopropanoate?
2-aminopentanoic acid;methyl 2-oxopropanoate has a molecular weight of 219.24 g/mol, XLogP of -0.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanoic acid;methyl 2-oxopropanoate is sourced from PubChem (CID 144928347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).