(2R)-2-(15N)azanyl(313C)pentanoic acid

C5H11NO2 — CID 157463358

IUPAC(2R)-2-(15N)azanyl(313C)pentanoic acid
SMILESCC[13CH2][C@@H]([15NH2])C(=O)O
InChIInChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1/i3+1,6+1
InChIKeySNDPXSYFESPGGJ-BWHLFBDRSA-N
MW119.13 g/mol
LogP0.20
Rot. Bonds3

About (2R)-2-(15N)azanyl(313C)pentanoic acid

(2R)-2-(15N)azanyl(313C)pentanoic acid (PubChem CID 157463358) has the molecular formula C5H11NO2 and a molecular weight of 119.13 g/mol. Its IUPAC name is (2R)-2-(15N)azanyl(313C)pentanoic acid.

Molecular Properties

Compound Name(2R)-2-(15N)azanyl(313C)pentanoic acid
PubChem CID157463358
Molecular FormulaC5H11NO2
Molecular Weight119.13 g/mol
Exact Mass119.08
IUPAC Name(2R)-2-(15N)azanyl(313C)pentanoic acid
SMILESCC[13CH2][C@@H]([15NH2])C(=O)O
InChIInChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1/i3+1,6+1
InChIKeySNDPXSYFESPGGJ-BWHLFBDRSA-N
XLogP0.20
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500119.13
LogP ≤ 50.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(15N)azanyl(313C)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-amino(311C)pentanoic acid
CID 55291456
(2S)-2-aminohexanoic acid;(2R)-2-aminopentanoic acid
CID 158530553
2-aminopentanoic acid;pentanoic acid
CID 158644900
2-aminopentanoic acid;(2S)-2,6-diaminohexanoic acid
CID 121439677
2-aminopentanoic acid;methyl 2-oxopropanoate
CID 144928347
(2S)-2-amino-4-ethylsulfanylbutanoic acid;(2S)-2-aminopentanoic acid
CID 122574248
(2S)-2-aminohexanoic acid;dihydrochloride
CID 142770522
(2S,5S)-2,5-diaminohexanedioic acid
CID 22871875
4-aminobutanoic acid;(2S)-2-aminopentanoic acid
CID 18598089
(2S)-2-aminopentacosanoic acid
CID 158815459
2-aminotetracosanoic acid
CID 88730229
(2S)-2-aminododecanoic acid
CID 10560640

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(15N)azanyl(313C)pentanoic acid?
The IUPAC name of (2R)-2-(15N)azanyl(313C)pentanoic acid (CID 157463358) is (2R)-2-(15N)azanyl(313C)pentanoic acid.
What is the SMILES notation for (2R)-2-(15N)azanyl(313C)pentanoic acid?
The canonical SMILES for (2R)-2-(15N)azanyl(313C)pentanoic acid is CC[13CH2][C@@H]([15NH2])C(=O)O.
What is the InChIKey of (2R)-2-(15N)azanyl(313C)pentanoic acid?
The InChIKey is SNDPXSYFESPGGJ-BWHLFBDRSA-N. The full InChI is InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1/i3+1,6+1.
What are the key properties of (2R)-2-(15N)azanyl(313C)pentanoic acid?
(2R)-2-(15N)azanyl(313C)pentanoic acid has a molecular weight of 119.13 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(15N)azanyl(313C)pentanoic acid is sourced from PubChem (CID 157463358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).