About (2S)-2-aminododecanoic acid
(2S)-2-aminododecanoic acid (PubChem CID 10560640) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is (2S)-2-aminododecanoic acid.
Molecular Properties
| Compound Name | (2S)-2-aminododecanoic acid |
| PubChem CID | 10560640 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (2S)-2-aminododecanoic acid |
| SMILES | CCCCCCCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H25NO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10,13H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | QUBNFZFTFXTLKH-NSHDSACASA-N |
| XLogP | 2.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminododecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminododecanoic acid?
The IUPAC name of (2S)-2-aminododecanoic acid (CID 10560640) is (2S)-2-aminododecanoic acid.
What is the SMILES notation for (2S)-2-aminododecanoic acid?
The canonical SMILES for (2S)-2-aminododecanoic acid is CCCCCCCCCC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-aminododecanoic acid?
The InChIKey is QUBNFZFTFXTLKH-NSHDSACASA-N. The full InChI is InChI=1S/C12H25NO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10,13H2,1H3,(H,14,15)/t11-/m0/s1.
What are the key properties of (2S)-2-aminododecanoic acid?
(2S)-2-aminododecanoic acid has a molecular weight of 215.34 g/mol, XLogP of 2.93, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminododecanoic acid is sourced from PubChem (CID 10560640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).