About (2S)-2-aminohexanoic acid;dihydrochloride
(2S)-2-aminohexanoic acid;dihydrochloride (PubChem CID 142770522) has the molecular formula C6H15Cl2NO2
and a molecular weight of 204.10 g/mol. Its IUPAC name is (2S)-2-aminohexanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | (2S)-2-aminohexanoic acid;dihydrochloride |
| PubChem CID | 142770522 |
| Molecular Formula | C6H15Cl2NO2 |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (2S)-2-aminohexanoic acid;dihydrochloride |
| SMILES | CCCC[C@H](N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C6H13NO2.2ClH/c1-2-3-4-5(7)6(8)9;;/h5H,2-4,7H2,1H3,(H,8,9);2*1H/t5-;;/m0../s1 |
| InChIKey | QBAIOPZNPXCHFM-XRIGFGBMSA-N |
| XLogP | 1.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-aminohexanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminohexanoic acid;dihydrochloride?
The IUPAC name of (2S)-2-aminohexanoic acid;dihydrochloride (CID 142770522) is (2S)-2-aminohexanoic acid;dihydrochloride.
What is the SMILES notation for (2S)-2-aminohexanoic acid;dihydrochloride?
The canonical SMILES for (2S)-2-aminohexanoic acid;dihydrochloride is CCCC[C@H](N)C(=O)O.Cl.Cl.
What is the InChIKey of (2S)-2-aminohexanoic acid;dihydrochloride?
The InChIKey is QBAIOPZNPXCHFM-XRIGFGBMSA-N. The full InChI is InChI=1S/C6H13NO2.2ClH/c1-2-3-4-5(7)6(8)9;;/h5H,2-4,7H2,1H3,(H,8,9);2*1H/t5-;;/m0../s1.
What are the key properties of (2S)-2-aminohexanoic acid;dihydrochloride?
(2S)-2-aminohexanoic acid;dihydrochloride has a molecular weight of 204.10 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminohexanoic acid;dihydrochloride is sourced from PubChem (CID 142770522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).