C11H24N2O5S — CID 90017502
(2S)-2-aminohexanoic acid;(2S)-2-amino-4-methylsulfinylbutanoic acid (PubChem CID 90017502) has the molecular formula C11H24N2O5S and a molecular weight of 296.39 g/mol. Its IUPAC name is (2S)-2-aminohexanoic acid;(2S)-2-amino-4-methylsulfinylbutanoic acid.
| Compound Name | (2S)-2-aminohexanoic acid;(2S)-2-amino-4-methylsulfinylbutanoic acid |
|---|---|
| PubChem CID | 90017502 |
| Molecular Formula | C11H24N2O5S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2S)-2-aminohexanoic acid;(2S)-2-amino-4-methylsulfinylbutanoic acid |
| SMILES | CCCC[C@H](N)C(=O)O.CS(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2.C5H11NO3S/c1-2-3-4-5(7)6(8)9;1-10(9)3-2-4(6)5(7)8/h5H,2-4,7H2,1H3,(H,8,9);4H,2-3,6H2,1H3,(H,7,8)/t5-;4-,10?/m00/s1 |
| InChIKey | XCPARMZABSOSIT-AXRPPBDMSA-N |
| XLogP | -0.24 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |