C10H23NO6S2 — CID 88801630
(2S)-2-amino-4-methylsulfinylbutanoic acid;butanoic acid;hydroxysulfanylmethane (PubChem CID 88801630) has the molecular formula C10H23NO6S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfinylbutanoic acid;butanoic acid;hydroxysulfanylmethane.
| Compound Name | (2S)-2-amino-4-methylsulfinylbutanoic acid;butanoic acid;hydroxysulfanylmethane |
|---|---|
| PubChem CID | 88801630 |
| Molecular Formula | C10H23NO6S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (2S)-2-amino-4-methylsulfinylbutanoic acid;butanoic acid;hydroxysulfanylmethane |
| SMILES | CCCC(=O)O.CS(=O)CC[C@H](N)C(=O)O.CSO |
| InChI | InChI=1S/C5H11NO3S.C4H8O2.CH4OS/c1-10(9)3-2-4(6)5(7)8;1-2-3-4(5)6;1-3-2/h4H,2-3,6H2,1H3,(H,7,8);2-3H2,1H3,(H,5,6);2H,1H3/t4-,10?;;/m0../s1 |
| InChIKey | WDNBGYHTTQODBW-SUXKNWAXSA-N |
| XLogP | 0.86 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|