C5H9NO4 — CID 121494059
(2R)-2-amino(1,2,3,4,5-13C5)pentanedioic acid (PubChem CID 121494059) has the molecular formula C5H9NO4 and a molecular weight of 152.09 g/mol. Its IUPAC name is (2R)-2-amino(1,2,3,4,5-13C5)pentanedioic acid.
| Compound Name | (2R)-2-amino(1,2,3,4,5-13C5)pentanedioic acid |
|---|---|
| PubChem CID | 121494059 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 152.09 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | (2R)-2-amino(1,2,3,4,5-13C5)pentanedioic acid |
| SMILES | N[13C@H]([13CH2][13CH2][13C](=O)O)[13C](=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1/i1+1,2+1,3+1,4+1,5+1 |
| InChIKey | WHUUTDBJXJRKMK-GKVKFTTQSA-N |
| XLogP | -0.74 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.09 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |