About 2-aminopentanedioic acid;hexahydrate
2-aminopentanedioic acid;hexahydrate (PubChem CID 173177476) has the molecular formula C5H21NO10
and a molecular weight of 255.22 g/mol. Its IUPAC name is 2-aminopentanedioic acid;hexahydrate.
Molecular Properties
| Compound Name | 2-aminopentanedioic acid;hexahydrate |
| PubChem CID | 173177476 |
| Molecular Formula | C5H21NO10 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-aminopentanedioic acid;hexahydrate |
| SMILES | NC(CCC(=O)O)C(=O)O.O.O.O.O.O.O |
| InChI | InChI=1S/C5H9NO4.6H2O/c6-3(5(9)10)1-2-4(7)8;;;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);6*1H2 |
| InChIKey | VRGIFBHZMLKFIK-UHFFFAOYSA-N |
| XLogP | -5.69 |
| TPSA | 289.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | -5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminopentanedioic acid;hexahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanedioic acid;hexahydrate?
The IUPAC name of 2-aminopentanedioic acid;hexahydrate (CID 173177476) is 2-aminopentanedioic acid;hexahydrate.
What is the SMILES notation for 2-aminopentanedioic acid;hexahydrate?
The canonical SMILES for 2-aminopentanedioic acid;hexahydrate is NC(CCC(=O)O)C(=O)O.O.O.O.O.O.O.
What is the InChIKey of 2-aminopentanedioic acid;hexahydrate?
The InChIKey is VRGIFBHZMLKFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4.6H2O/c6-3(5(9)10)1-2-4(7)8;;;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);6*1H2.
What are the key properties of 2-aminopentanedioic acid;hexahydrate?
2-aminopentanedioic acid;hexahydrate has a molecular weight of 255.22 g/mol, XLogP of -5.69, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanedioic acid;hexahydrate is sourced from PubChem (CID 173177476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).