C13H21NO12 — CID 174955338
2-aminopentanedioic acid;bis(butanedioic acid) (PubChem CID 174955338) has the molecular formula C13H21NO12 and a molecular weight of 383.31 g/mol. Its IUPAC name is 2-aminopentanedioic acid;bis(butanedioic acid).
| Compound Name | 2-aminopentanedioic acid;bis(butanedioic acid) |
|---|---|
| PubChem CID | 174955338 |
| Molecular Formula | C13H21NO12 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-aminopentanedioic acid;bis(butanedioic acid) |
| SMILES | NC(CCC(=O)O)C(=O)O.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C5H9NO4.2C4H6O4/c6-3(5(9)10)1-2-4(7)8;2*5-3(6)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10);2*1-2H2,(H,5,6)(H,7,8) |
| InChIKey | QMJSDZTVHKRHEA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 249.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |