About (2S)-2-aminopentanedioic acid;heptahydrate
(2S)-2-aminopentanedioic acid;heptahydrate (PubChem CID 156766287) has the molecular formula C5H23NO11
and a molecular weight of 273.23 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;heptahydrate.
Molecular Properties
| Compound Name | (2S)-2-aminopentanedioic acid;heptahydrate |
| PubChem CID | 156766287 |
| Molecular Formula | C5H23NO11 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;heptahydrate |
| SMILES | N[C@@H](CCC(=O)O)C(=O)O.O.O.O.O.O.O.O |
| InChI | InChI=1S/C5H9NO4.7H2O/c6-3(5(9)10)1-2-4(7)8;;;;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);7*1H2/t3-;;;;;;;/m0......./s1 |
| InChIKey | KSHNOVPDHABGKD-WIMOTELVSA-N |
| XLogP | -6.51 |
| TPSA | 321.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | -6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-aminopentanedioic acid;heptahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanedioic acid;heptahydrate?
The IUPAC name of (2S)-2-aminopentanedioic acid;heptahydrate (CID 156766287) is (2S)-2-aminopentanedioic acid;heptahydrate.
What is the SMILES notation for (2S)-2-aminopentanedioic acid;heptahydrate?
The canonical SMILES for (2S)-2-aminopentanedioic acid;heptahydrate is N[C@@H](CCC(=O)O)C(=O)O.O.O.O.O.O.O.O.
What is the InChIKey of (2S)-2-aminopentanedioic acid;heptahydrate?
The InChIKey is KSHNOVPDHABGKD-WIMOTELVSA-N. The full InChI is InChI=1S/C5H9NO4.7H2O/c6-3(5(9)10)1-2-4(7)8;;;;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);7*1H2/t3-;;;;;;;/m0......./s1.
What are the key properties of (2S)-2-aminopentanedioic acid;heptahydrate?
(2S)-2-aminopentanedioic acid;heptahydrate has a molecular weight of 273.23 g/mol, XLogP of -6.51, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanedioic acid;heptahydrate is sourced from PubChem (CID 156766287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).