About 2-aminopentanedioic acid;hydrazine;hydrate
2-aminopentanedioic acid;hydrazine;hydrate (PubChem CID 174836274) has the molecular formula C5H15N3O5
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-aminopentanedioic acid;hydrazine;hydrate.
Molecular Properties
| Compound Name | 2-aminopentanedioic acid;hydrazine;hydrate |
| PubChem CID | 174836274 |
| Molecular Formula | C5H15N3O5 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-aminopentanedioic acid;hydrazine;hydrate |
| SMILES | NC(CCC(=O)O)C(=O)O.NN.O |
| InChI | InChI=1S/C5H9NO4.H4N2.H2O/c6-3(5(9)10)1-2-4(7)8;1-2;/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2H2;1H2 |
| InChIKey | HUKCRAQIRIYLJZ-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 184.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopentanedioic acid;hydrazine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanedioic acid;hydrazine;hydrate?
The IUPAC name of 2-aminopentanedioic acid;hydrazine;hydrate (CID 174836274) is 2-aminopentanedioic acid;hydrazine;hydrate.
What is the SMILES notation for 2-aminopentanedioic acid;hydrazine;hydrate?
The canonical SMILES for 2-aminopentanedioic acid;hydrazine;hydrate is NC(CCC(=O)O)C(=O)O.NN.O.
What is the InChIKey of 2-aminopentanedioic acid;hydrazine;hydrate?
The InChIKey is HUKCRAQIRIYLJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4.H4N2.H2O/c6-3(5(9)10)1-2-4(7)8;1-2;/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2H2;1H2.
What are the key properties of 2-aminopentanedioic acid;hydrazine;hydrate?
2-aminopentanedioic acid;hydrazine;hydrate has a molecular weight of 197.19 g/mol, XLogP of -2.74, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanedioic acid;hydrazine;hydrate is sourced from PubChem (CID 174836274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).