About (2R)-2-aminopentanedioic acid;hydrate
(2R)-2-aminopentanedioic acid;hydrate (PubChem CID 87451212) has the molecular formula C5H11NO5
and a molecular weight of 165.14 g/mol. Its IUPAC name is (2R)-2-aminopentanedioic acid;hydrate.
Molecular Properties
| Compound Name | (2R)-2-aminopentanedioic acid;hydrate |
| PubChem CID | 87451212 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2R)-2-aminopentanedioic acid;hydrate |
| SMILES | N[C@H](CCC(=O)O)C(=O)O.O |
| InChI | InChI=1S/C5H9NO4.H2O/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H2/t3-;/m1./s1 |
| InChIKey | OZDAOHVKBFBBMZ-AENDTGMFSA-N |
| XLogP | -1.56 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-aminopentanedioic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminopentanedioic acid;hydrate?
The IUPAC name of (2R)-2-aminopentanedioic acid;hydrate (CID 87451212) is (2R)-2-aminopentanedioic acid;hydrate.
What is the SMILES notation for (2R)-2-aminopentanedioic acid;hydrate?
The canonical SMILES for (2R)-2-aminopentanedioic acid;hydrate is N[C@H](CCC(=O)O)C(=O)O.O.
What is the InChIKey of (2R)-2-aminopentanedioic acid;hydrate?
The InChIKey is OZDAOHVKBFBBMZ-AENDTGMFSA-N. The full InChI is InChI=1S/C5H9NO4.H2O/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H2/t3-;/m1./s1.
What are the key properties of (2R)-2-aminopentanedioic acid;hydrate?
(2R)-2-aminopentanedioic acid;hydrate has a molecular weight of 165.14 g/mol, XLogP of -1.56, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminopentanedioic acid;hydrate is sourced from PubChem (CID 87451212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).