About (2S)-2-aminopentanedioic acid;trihydrochloride
(2S)-2-aminopentanedioic acid;trihydrochloride (PubChem CID 140679884) has the molecular formula C5H12Cl3NO4
and a molecular weight of 256.51 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;trihydrochloride.
Molecular Properties
| Compound Name | (2S)-2-aminopentanedioic acid;trihydrochloride |
| PubChem CID | 140679884 |
| Molecular Formula | C5H12Cl3NO4 |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;trihydrochloride |
| SMILES | Cl.Cl.Cl.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.3ClH/c6-3(5(9)10)1-2-4(7)8;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);3*1H/t3-;;;/m0.../s1 |
| InChIKey | ABWIMTKYKNFIRB-LHWPGRLPSA-N |
| XLogP | 0.53 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-aminopentanedioic acid;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanedioic acid;trihydrochloride?
The IUPAC name of (2S)-2-aminopentanedioic acid;trihydrochloride (CID 140679884) is (2S)-2-aminopentanedioic acid;trihydrochloride.
What is the SMILES notation for (2S)-2-aminopentanedioic acid;trihydrochloride?
The canonical SMILES for (2S)-2-aminopentanedioic acid;trihydrochloride is Cl.Cl.Cl.N[C@@H](CCC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-aminopentanedioic acid;trihydrochloride?
The InChIKey is ABWIMTKYKNFIRB-LHWPGRLPSA-N. The full InChI is InChI=1S/C5H9NO4.3ClH/c6-3(5(9)10)1-2-4(7)8;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);3*1H/t3-;;;/m0.../s1.
What are the key properties of (2S)-2-aminopentanedioic acid;trihydrochloride?
(2S)-2-aminopentanedioic acid;trihydrochloride has a molecular weight of 256.51 g/mol, XLogP of 0.53, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanedioic acid;trihydrochloride is sourced from PubChem (CID 140679884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).