C13H23NO10 — CID 158042899
(2S)-2-aminopentanedioic acid;butanedioic acid;butanoic acid (PubChem CID 158042899) has the molecular formula C13H23NO10 and a molecular weight of 353.32 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;butanedioic acid;butanoic acid.
| Compound Name | (2S)-2-aminopentanedioic acid;butanedioic acid;butanoic acid |
|---|---|
| PubChem CID | 158042899 |
| Molecular Formula | C13H23NO10 |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;butanedioic acid;butanoic acid |
| SMILES | CCCC(=O)O.N[C@@H](CCC(=O)O)C(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C5H9NO4.C4H6O4.C4H8O2/c6-3(5(9)10)1-2-4(7)8;5-3(6)1-2-4(7)8;1-2-3-4(5)6/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2H2,(H,5,6)(H,7,8);2-3H2,1H3,(H,5,6)/t3-;;/m0../s1 |
| InChIKey | FIOIWOCNGQOOFJ-QTNFYWBSSA-N |
| XLogP | 0.07 |
| TPSA | 212.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |