C17H33NO6 — CID 175003829
2-aminopentanedioic acid;dodecanoic acid (PubChem CID 175003829) has the molecular formula C17H33NO6 and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-aminopentanedioic acid;dodecanoic acid.
| Compound Name | 2-aminopentanedioic acid;dodecanoic acid |
|---|---|
| PubChem CID | 175003829 |
| Molecular Formula | C17H33NO6 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-aminopentanedioic acid;dodecanoic acid |
| SMILES | CCCCCCCCCCCC(=O)O.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H24O2.C5H9NO4/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;6-3(5(9)10)1-2-4(7)8/h2-11H2,1H3,(H,13,14);3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | UMBHVAZDOAKHJC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|