C16H31NO6 — CID 131742199
(2S)-2-aminobutanedioic acid;dodecanoic acid (PubChem CID 131742199) has the molecular formula C16H31NO6 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;dodecanoic acid.
| Compound Name | (2S)-2-aminobutanedioic acid;dodecanoic acid |
|---|---|
| PubChem CID | 131742199 |
| Molecular Formula | C16H31NO6 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;dodecanoic acid |
| SMILES | CCCCCCCCCCCC(=O)O.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H24O2.C4H7NO4/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;5-2(4(8)9)1-3(6)7/h2-11H2,1H3,(H,13,14);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | KFCULUCJYPOAFY-WNQIDUERSA-N |
| XLogP | 2.86 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|