About (2S)-2-aminopropanoic acid;decanoic acid
(2S)-2-aminopropanoic acid;decanoic acid (PubChem CID 89052337) has the molecular formula C13H27NO4
and a molecular weight of 261.36 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;decanoic acid.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;decanoic acid |
| PubChem CID | 89052337 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (2S)-2-aminopropanoic acid;decanoic acid |
| SMILES | CCCCCCCCCC(=O)O.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H20O2.C3H7NO2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2(4)3(5)6/h2-9H2,1H3,(H,11,12);2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | IACQJCNRYQXZNJ-WNQIDUERSA-N |
| XLogP | 2.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopropanoic acid;decanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;decanoic acid?
The IUPAC name of (2S)-2-aminopropanoic acid;decanoic acid (CID 89052337) is (2S)-2-aminopropanoic acid;decanoic acid.
What is the SMILES notation for (2S)-2-aminopropanoic acid;decanoic acid?
The canonical SMILES for (2S)-2-aminopropanoic acid;decanoic acid is CCCCCCCCCC(=O)O.C[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-aminopropanoic acid;decanoic acid?
The InChIKey is IACQJCNRYQXZNJ-WNQIDUERSA-N. The full InChI is InChI=1S/C10H20O2.C3H7NO2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2(4)3(5)6/h2-9H2,1H3,(H,11,12);2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminopropanoic acid;decanoic acid?
(2S)-2-aminopropanoic acid;decanoic acid has a molecular weight of 261.36 g/mol, XLogP of 2.63, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;decanoic acid is sourced from PubChem (CID 89052337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).