C12H22N2O8 — CID 161168741
(2S)-2-aminobutanedioic acid;2-aminooctanedioic acid (PubChem CID 161168741) has the molecular formula C12H22N2O8 and a molecular weight of 322.31 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;2-aminooctanedioic acid.
| Compound Name | (2S)-2-aminobutanedioic acid;2-aminooctanedioic acid |
|---|---|
| PubChem CID | 161168741 |
| Molecular Formula | C12H22N2O8 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;2-aminooctanedioic acid |
| SMILES | NC(CCCCCC(=O)O)C(=O)O.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4.C4H7NO4/c9-6(8(12)13)4-2-1-3-5-7(10)11;5-2(4(8)9)1-3(6)7/h6H,1-5,9H2,(H,10,11)(H,12,13);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | UQWZNZSZOOJMIO-WNQIDUERSA-N |
| XLogP | -0.69 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|