C21H37N5O20 — CID 160730192
tetrakis((2S)-2-aminobutanedioic acid);(2S)-2-aminopentanedioic acid (PubChem CID 160730192) has the molecular formula C21H37N5O20 and a molecular weight of 679.54 g/mol. Its IUPAC name is tetrakis((2S)-2-aminobutanedioic acid);(2S)-2-aminopentanedioic acid.
| Compound Name | tetrakis((2S)-2-aminobutanedioic acid);(2S)-2-aminopentanedioic acid |
|---|---|
| PubChem CID | 160730192 |
| Molecular Formula | C21H37N5O20 |
| Molecular Weight | 679.54 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | tetrakis((2S)-2-aminobutanedioic acid);(2S)-2-aminopentanedioic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.N[C@@H](CC(=O)O)C(=O)O.N[C@@H](CC(=O)O)C(=O)O.N[C@@H](CC(=O)O)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.4C4H7NO4/c6-3(5(9)10)1-2-4(7)8;4*5-2(4(8)9)1-3(6)7/h3H,1-2,6H2,(H,7,8)(H,9,10);4*2H,1,5H2,(H,6,7)(H,8,9)/t3-;4*2-/m00000/s1 |
| InChIKey | RUFQXZCQYKGGRU-PHXUEVMYSA-N |
| XLogP | -5.24 |
| TPSA | 503.10 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.54 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 15 |