C14H25N3O12 — CID 87733347
(2S)-2-aminobutanedioic acid;bis((2S)-2-aminopentanedioic acid) (PubChem CID 87733347) has the molecular formula C14H25N3O12 and a molecular weight of 427.36 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;bis((2S)-2-aminopentanedioic acid).
| Compound Name | (2S)-2-aminobutanedioic acid;bis((2S)-2-aminopentanedioic acid) |
|---|---|
| PubChem CID | 87733347 |
| Molecular Formula | C14H25N3O12 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;bis((2S)-2-aminopentanedioic acid) |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/2C5H9NO4.C4H7NO4/c2*6-3(5(9)10)1-2-4(7)8;5-2(4(8)9)1-3(6)7/h2*3H,1-2,6H2,(H,7,8)(H,9,10);2H,1,5H2,(H,6,7)(H,8,9)/t2*3-;2-/m000/s1 |
| InChIKey | VCDFXVNLRNAZHJ-SYMLPCKFSA-N |
| XLogP | -2.60 |
| TPSA | 301.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |