C16H35N5O8 — CID 138592337
2-aminobutanedioic acid;bis(2,6-diaminohexanoic acid) (PubChem CID 138592337) has the molecular formula C16H35N5O8 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-aminobutanedioic acid;bis(2,6-diaminohexanoic acid).
| Compound Name | 2-aminobutanedioic acid;bis(2,6-diaminohexanoic acid) |
|---|---|
| PubChem CID | 138592337 |
| Molecular Formula | C16H35N5O8 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 2-aminobutanedioic acid;bis(2,6-diaminohexanoic acid) |
| SMILES | NC(CC(=O)O)C(=O)O.NCCCCC(N)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/2C6H14N2O2.C4H7NO4/c2*7-4-2-1-3-5(8)6(9)10;5-2(4(8)9)1-3(6)7/h2*5H,1-4,7-8H2,(H,9,10);2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | VJEARRUOJRALFA-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 279.30 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|