C13H28N2O2 — CID 141414897
2,13-diaminotridecanoic acid (PubChem CID 141414897) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2,13-diaminotridecanoic acid.
| Compound Name | 2,13-diaminotridecanoic acid |
|---|---|
| PubChem CID | 141414897 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2,13-diaminotridecanoic acid |
| SMILES | NCCCCCCCCCCCC(N)C(=O)O |
| InChI | InChI=1S/C13H28N2O2/c14-11-9-7-5-3-1-2-4-6-8-10-12(15)13(16)17/h12H,1-11,14-15H2,(H,16,17) |
| InChIKey | CPVSVFXCVPMFTH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|