C6H16Cl2N2O2 — CID 163409206
(2S)-2,6-bis(15N)(azanyl)hexanoic acid;dihydrochloride (PubChem CID 163409206) has the molecular formula C6H16Cl2N2O2 and a molecular weight of 221.10 g/mol. Its IUPAC name is (2S)-2,6-bis(15N)(azanyl)hexanoic acid;dihydrochloride.
| Compound Name | (2S)-2,6-bis(15N)(azanyl)hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 163409206 |
| Molecular Formula | C6H16Cl2N2O2 |
| Molecular Weight | 221.10 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (2S)-2,6-bis(15N)(azanyl)hexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.[15NH2]CCCC[C@H]([15NH2])C(=O)O |
| InChI | InChI=1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/t5-;;/m0../s1/i7+1,8+1;; |
| InChIKey | JBBURJFZIMRPCZ-WLJXYRRISA-N |
| XLogP | 0.37 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.10 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|