C6H15Cl2KN2O2 — CID 161346238
potassium;(2S)-2,6-diaminohexanoic acid;chloride;hydrochloride (PubChem CID 161346238) has the molecular formula C6H15Cl2KN2O2 and a molecular weight of 257.20 g/mol. Its IUPAC name is potassium;(2S)-2,6-diaminohexanoic acid;chloride;hydrochloride.
| Compound Name | potassium;(2S)-2,6-diaminohexanoic acid;chloride;hydrochloride |
|---|---|
| PubChem CID | 161346238 |
| Molecular Formula | C6H15Cl2KN2O2 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | potassium;(2S)-2,6-diaminohexanoic acid;chloride;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)C(=O)O.[Cl-].[K+] |
| InChI | InChI=1S/C6H14N2O2.2ClH.K/c7-4-2-1-3-5(8)6(9)10;;;/h5H,1-4,7-8H2,(H,9,10);2*1H;/q;;;+1/p-1/t5-;;;/m0.../s1 |
| InChIKey | VNIFETSHLUSUFZ-BHRFRFAJSA-M |
| XLogP | -6.04 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|