C16H27NO9 — CID 158254947
(2S)-2-aminooctanedioic acid;2-oxooctanedioic acid (PubChem CID 158254947) has the molecular formula C16H27NO9 and a molecular weight of 377.39 g/mol. Its IUPAC name is (2S)-2-aminooctanedioic acid;2-oxooctanedioic acid.
| Compound Name | (2S)-2-aminooctanedioic acid;2-oxooctanedioic acid |
|---|---|
| PubChem CID | 158254947 |
| Molecular Formula | C16H27NO9 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2S)-2-aminooctanedioic acid;2-oxooctanedioic acid |
| SMILES | N[C@@H](CCCCCC(=O)O)C(=O)O.O=C(O)CCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C8H15NO4.C8H12O5/c2*9-6(8(12)13)4-2-1-3-5-7(10)11/h6H,1-5,9H2,(H,10,11)(H,12,13);1-5H2,(H,10,11)(H,12,13)/t6-;/m0./s1 |
| InChIKey | GHDZUEGIZVYSAM-RGMNGODLSA-N |
| XLogP | 1.11 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|