C12H19NO9 — CID 175488251
2-aminohexanedioic acid;2-oxohexanedioic acid (PubChem CID 175488251) has the molecular formula C12H19NO9 and a molecular weight of 321.28 g/mol. Its IUPAC name is 2-aminohexanedioic acid;2-oxohexanedioic acid.
| Compound Name | 2-aminohexanedioic acid;2-oxohexanedioic acid |
|---|---|
| PubChem CID | 175488251 |
| Molecular Formula | C12H19NO9 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-aminohexanedioic acid;2-oxohexanedioic acid |
| SMILES | NC(CCCC(=O)O)C(=O)O.O=C(O)CCCC(=O)C(=O)O |
| InChI | InChI=1S/C6H11NO4.C6H8O5/c2*7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11);1-3H2,(H,8,9)(H,10,11) |
| InChIKey | HEHWBRLCKKANNH-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|