C12H20N2O9 — CID 138506227
2,6-diaminoheptanedioic acid;2-oxopentanedioic acid (PubChem CID 138506227) has the molecular formula C12H20N2O9 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid.
| Compound Name | 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid |
|---|---|
| PubChem CID | 138506227 |
| Molecular Formula | C12H20N2O9 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid |
| SMILES | NC(CCCC(N)C(=O)O)C(=O)O.O=C(O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4.C5H6O5/c8-4(6(10)11)2-1-3-5(9)7(12)13;6-3(5(9)10)1-2-4(7)8/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13);1-2H2,(H,7,8)(H,9,10) |
| InChIKey | WHSLLSCAAWSSHU-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|