2,6-diaminoheptanedioic acid;2-oxopentanedioic acid

C12H20N2O9 — CID 138506227

IUPAC2,6-diaminoheptanedioic acid;2-oxopentanedioic acid
SMILESNC(CCCC(N)C(=O)O)C(=O)O.O=C(O)CCC(=O)C(=O)O
InChIInChI=1S/C7H14N2O4.C5H6O5/c8-4(6(10)11)2-1-3-5(9)7(12)13;6-3(5(9)10)1-2-4(7)8/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13);1-2H2,(H,7,8)(H,9,10)
InChIKeyWHSLLSCAAWSSHU-UHFFFAOYSA-N
MW336.30 g/mol
LogP-1.51
Rot. Bonds10

About 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid

2,6-diaminoheptanedioic acid;2-oxopentanedioic acid (PubChem CID 138506227) has the molecular formula C12H20N2O9 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid.

Molecular Properties

Compound Name2,6-diaminoheptanedioic acid;2-oxopentanedioic acid
PubChem CID138506227
Molecular FormulaC12H20N2O9
Molecular Weight336.30 g/mol
Exact Mass336.12
IUPAC Name2,6-diaminoheptanedioic acid;2-oxopentanedioic acid
SMILESNC(CCCC(N)C(=O)O)C(=O)O.O=C(O)CCC(=O)C(=O)O
InChIInChI=1S/C7H14N2O4.C5H6O5/c8-4(6(10)11)2-1-3-5(9)7(12)13;6-3(5(9)10)1-2-4(7)8/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13);1-2H2,(H,7,8)(H,9,10)
InChIKeyWHSLLSCAAWSSHU-UHFFFAOYSA-N
XLogP-1.51
TPSA218.31 Ų
H-Bond Donors6
H-Bond Acceptors7
Rotatable Bonds10
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500336.30
LogP ≤ 5-1.51
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid?
The IUPAC name of 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid (CID 138506227) is 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid.
What is the SMILES notation for 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid?
The canonical SMILES for 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid is NC(CCCC(N)C(=O)O)C(=O)O.O=C(O)CCC(=O)C(=O)O.
What is the InChIKey of 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid?
The InChIKey is WHSLLSCAAWSSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O4.C5H6O5/c8-4(6(10)11)2-1-3-5(9)7(12)13;6-3(5(9)10)1-2-4(7)8/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13);1-2H2,(H,7,8)(H,9,10).
What are the key properties of 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid?
2,6-diaminoheptanedioic acid;2-oxopentanedioic acid has a molecular weight of 336.30 g/mol, XLogP of -1.51, 10 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diaminoheptanedioic acid;2-oxopentanedioic acid is sourced from PubChem (CID 138506227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).