C20H36N4O15 — CID 158953079
bis((2S)-2-aminopentanedioic acid);(2S)-2,5-diaminopentanoic acid;2-oxopentanedioic acid (PubChem CID 158953079) has the molecular formula C20H36N4O15 and a molecular weight of 572.52 g/mol. Its IUPAC name is bis((2S)-2-aminopentanedioic acid);(2S)-2,5-diaminopentanoic acid;2-oxopentanedioic acid.
| Compound Name | bis((2S)-2-aminopentanedioic acid);(2S)-2,5-diaminopentanoic acid;2-oxopentanedioic acid |
|---|---|
| PubChem CID | 158953079 |
| Molecular Formula | C20H36N4O15 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | bis((2S)-2-aminopentanedioic acid);(2S)-2,5-diaminopentanoic acid;2-oxopentanedioic acid |
| SMILES | NCCC[C@H](N)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O.O=C(O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C5H12N2O2.2C5H9NO4.C5H6O5/c6-3-1-2-4(7)5(8)9;3*6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);2*3H,1-2,6H2,(H,7,8)(H,9,10);1-2H2,(H,7,8)(H,9,10)/t4-;2*3-;/m000./s1 |
| InChIKey | JLRCTNWUNXYQBI-IIFNIELVSA-N |
| XLogP | -2.83 |
| TPSA | 382.25 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|