C10H21N3O6 — CID 22007993
2-aminopentanedioic acid;2,5-diaminopentanoic acid (PubChem CID 22007993) has the molecular formula C10H21N3O6 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-aminopentanedioic acid;2,5-diaminopentanoic acid.
| Compound Name | 2-aminopentanedioic acid;2,5-diaminopentanoic acid |
|---|---|
| PubChem CID | 22007993 |
| Molecular Formula | C10H21N3O6 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-aminopentanedioic acid;2,5-diaminopentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)O.NCCCC(N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2.C5H9NO4/c6-3-1-2-4(7)5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | VIEFTSJBTHRPQM-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |