carbamic acid;2,5-diaminopentanoic acid

C6H15N3O4 — CID 22153959

IUPACcarbamic acid;2,5-diaminopentanoic acid
SMILESNC(=O)O.NCCCC(N)C(=O)O
InChIInChI=1S/C5H12N2O2.CH3NO2/c6-3-1-2-4(7)5(8)9;2-1(3)4/h4H,1-3,6-7H2,(H,8,9);2H2,(H,3,4)
InChIKeyRZCOXEFQRHJIOX-UHFFFAOYSA-N
MW193.20 g/mol
LogP-1.24
Rot. Bonds4

About carbamic acid;2,5-diaminopentanoic acid

carbamic acid;2,5-diaminopentanoic acid (PubChem CID 22153959) has the molecular formula C6H15N3O4 and a molecular weight of 193.20 g/mol. Its IUPAC name is carbamic acid;2,5-diaminopentanoic acid.

Molecular Properties

Compound Namecarbamic acid;2,5-diaminopentanoic acid
PubChem CID22153959
Molecular FormulaC6H15N3O4
Molecular Weight193.20 g/mol
Exact Mass193.11
IUPAC Namecarbamic acid;2,5-diaminopentanoic acid
SMILESNC(=O)O.NCCCC(N)C(=O)O
InChIInChI=1S/C5H12N2O2.CH3NO2/c6-3-1-2-4(7)5(8)9;2-1(3)4/h4H,1-3,6-7H2,(H,8,9);2H2,(H,3,4)
InChIKeyRZCOXEFQRHJIOX-UHFFFAOYSA-N
XLogP-1.24
TPSA152.66 Ų
H-Bond Donors5
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.20
LogP ≤ 5-1.24
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 104

Analyze carbamic acid;2,5-diaminopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbamic acid;2,5-diaminopentanoic acid?
The IUPAC name of carbamic acid;2,5-diaminopentanoic acid (CID 22153959) is carbamic acid;2,5-diaminopentanoic acid.
What is the SMILES notation for carbamic acid;2,5-diaminopentanoic acid?
The canonical SMILES for carbamic acid;2,5-diaminopentanoic acid is NC(=O)O.NCCCC(N)C(=O)O.
What is the InChIKey of carbamic acid;2,5-diaminopentanoic acid?
The InChIKey is RZCOXEFQRHJIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2.CH3NO2/c6-3-1-2-4(7)5(8)9;2-1(3)4/h4H,1-3,6-7H2,(H,8,9);2H2,(H,3,4).
What are the key properties of carbamic acid;2,5-diaminopentanoic acid?
carbamic acid;2,5-diaminopentanoic acid has a molecular weight of 193.20 g/mol, XLogP of -1.24, 4 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;2,5-diaminopentanoic acid is sourced from PubChem (CID 22153959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).