C6H15N3O4 — CID 22153959
carbamic acid;2,5-diaminopentanoic acid (PubChem CID 22153959) has the molecular formula C6H15N3O4 and a molecular weight of 193.20 g/mol. Its IUPAC name is carbamic acid;2,5-diaminopentanoic acid.
| Compound Name | carbamic acid;2,5-diaminopentanoic acid |
|---|---|
| PubChem CID | 22153959 |
| Molecular Formula | C6H15N3O4 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | carbamic acid;2,5-diaminopentanoic acid |
| SMILES | NC(=O)O.NCCCC(N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2.CH3NO2/c6-3-1-2-4(7)5(8)9;2-1(3)4/h4H,1-3,6-7H2,(H,8,9);2H2,(H,3,4) |
| InChIKey | RZCOXEFQRHJIOX-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |