C10H23N3O2 — CID 141070703
2,7,10-triaminodecanoic acid (PubChem CID 141070703) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2,7,10-triaminodecanoic acid.
| Compound Name | 2,7,10-triaminodecanoic acid |
|---|---|
| PubChem CID | 141070703 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2,7,10-triaminodecanoic acid |
| SMILES | NCCCC(N)CCCCC(N)C(=O)O |
| InChI | InChI=1S/C10H23N3O2/c11-7-3-5-8(12)4-1-2-6-9(13)10(14)15/h8-9H,1-7,11-13H2,(H,14,15) |
| InChIKey | DSKONLCFFKFQSU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|