C5H12CeN2O2 — CID 175036694
cerium;(2R)-2,5-diaminopentanoic acid (PubChem CID 175036694) has the molecular formula C5H12CeN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is cerium;(2R)-2,5-diaminopentanoic acid.
| Compound Name | cerium;(2R)-2,5-diaminopentanoic acid |
|---|---|
| PubChem CID | 175036694 |
| Molecular Formula | C5H12CeN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | cerium;(2R)-2,5-diaminopentanoic acid |
| SMILES | NCCC[C@@H](N)C(=O)O.[Ce] |
| InChI | InChI=1S/C5H12N2O2.Ce/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);/t4-;/m1./s1 |
| InChIKey | CJQHQEMDESRYBX-PGMHMLKASA-N |
| XLogP | -0.86 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |