C14H32N4O6 — CID 174697274
bis(4-aminobutanoic acid);2,6-diaminohexanoic acid (PubChem CID 174697274) has the molecular formula C14H32N4O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is bis(4-aminobutanoic acid);2,6-diaminohexanoic acid.
| Compound Name | bis(4-aminobutanoic acid);2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 174697274 |
| Molecular Formula | C14H32N4O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | bis(4-aminobutanoic acid);2,6-diaminohexanoic acid |
| SMILES | NCCCC(=O)O.NCCCC(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.2C4H9NO2/c7-4-2-1-3-5(8)6(9)10;2*5-3-1-2-4(6)7/h5H,1-4,7-8H2,(H,9,10);2*1-3,5H2,(H,6,7) |
| InChIKey | RODOBABDMRWETL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 215.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|