C14H26N2O10 — CID 87800370
bis(butanedioic acid);2,6-diaminohexanoic acid (PubChem CID 87800370) has the molecular formula C14H26N2O10 and a molecular weight of 382.37 g/mol. Its IUPAC name is bis(butanedioic acid);2,6-diaminohexanoic acid.
| Compound Name | bis(butanedioic acid);2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 87800370 |
| Molecular Formula | C14H26N2O10 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | bis(butanedioic acid);2,6-diaminohexanoic acid |
| SMILES | NCCCCC(N)C(=O)O.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C6H14N2O2.2C4H6O4/c7-4-2-1-3-5(8)6(9)10;2*5-3(6)1-2-4(7)8/h5H,1-4,7-8H2,(H,9,10);2*1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PPPWGYCUZFQMFJ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 238.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|