C13H30N4O7 — CID 175329719
2-aminoethanol;(2S)-2-aminopentanedioic acid;(2S)-2,6-diaminohexanoic acid (PubChem CID 175329719) has the molecular formula C13H30N4O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-aminoethanol;(2S)-2-aminopentanedioic acid;(2S)-2,6-diaminohexanoic acid.
| Compound Name | 2-aminoethanol;(2S)-2-aminopentanedioic acid;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 175329719 |
| Molecular Formula | C13H30N4O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2-aminoethanol;(2S)-2-aminopentanedioic acid;(2S)-2,6-diaminohexanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.NCCO.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C5H9NO4.C2H7NO/c7-4-2-1-3-5(8)6(9)10;6-3(5(9)10)1-2-4(7)8;3-1-2-4/h5H,1-4,7-8H2,(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10);4H,1-3H2/t5-;3-;/m00./s1 |
| InChIKey | JFLJYSDYNCUSGM-PBUQCQDLSA-N |
| XLogP | -2.27 |
| TPSA | 236.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|