C9H18N2O6S — CID 162161622
(2S)-2-aminohexanedioic acid;(2R)-2-amino-3-sulfanylpropanoic acid (PubChem CID 162161622) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is (2S)-2-aminohexanedioic acid;(2R)-2-amino-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-aminohexanedioic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 162161622 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2S)-2-aminohexanedioic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
| SMILES | N[C@@H](CCCC(=O)O)C(=O)O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H11NO4.C3H7NO2S/c7-4(6(10)11)2-1-3-5(8)9;4-2(1-7)3(5)6/h4H,1-3,7H2,(H,8,9)(H,10,11);2,7H,1,4H2,(H,5,6)/t4-;2-/m00/s1 |
| InChIKey | ZMOFBPLZQFHXML-ZBRNBAAYSA-N |
| XLogP | -1.02 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|