C9H21N3O4S — CID 87256813
(2R)-2-amino-3-sulfanylpropanoic acid;(2S)-2,6-diaminohexanoic acid (PubChem CID 87256813) has the molecular formula C9H21N3O4S and a molecular weight of 267.35 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;(2S)-2,6-diaminohexanoic acid.
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 87256813 |
| Molecular Formula | C9H21N3O4S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;(2S)-2,6-diaminohexanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C3H7NO2S/c7-4-2-1-3-5(8)6(9)10;4-2(1-7)3(5)6/h5H,1-4,7-8H2,(H,9,10);2,7H,1,4H2,(H,5,6)/t5-;2-/m00/s1 |
| InChIKey | DZJDKHJKZNIGJX-KNIFDHDWSA-N |
| XLogP | -1.14 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|