C13H26N4O9S — CID 174295124
2-aminopentanedioic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid (PubChem CID 174295124) has the molecular formula C13H26N4O9S and a molecular weight of 414.44 g/mol. Its IUPAC name is 2-aminopentanedioic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid.
| Compound Name | 2-aminopentanedioic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174295124 |
| Molecular Formula | C13H26N4O9S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-aminopentanedioic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)O.NC(CCC(=O)O)C(=O)O.NC(CS)C(=O)O |
| InChI | InChI=1S/C5H10N2O3.C5H9NO4.C3H7NO2S/c2*6-3(5(9)10)1-2-4(7)8;4-2(1-7)3(5)6/h3H,1-2,6H2,(H2,7,8)(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10);2,7H,1,4H2,(H,5,6) |
| InChIKey | ZCFQWRXXZZKKNQ-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 270.35 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|