C5H10AlN2O3+3 — CID 20532187
aluminum 2,5-diamino-5-oxopentanoic acid (PubChem CID 20532187) has the molecular formula C5H10AlN2O3+3 and a molecular weight of 173.13 g/mol. Its IUPAC name is aluminum 2,5-diamino-5-oxopentanoic acid.
| Compound Name | aluminum 2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 20532187 |
| Molecular Formula | C5H10AlN2O3+3 |
| Molecular Weight | 173.13 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | aluminum 2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)O.[Al+3] |
| InChI | InChI=1S/C5H10N2O3.Al/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H2,7,8)(H,9,10);/q;+3 |
| InChIKey | BPAXQLROAGQVQP-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.13 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |